About (2R)-3,4-dihydroxyoxolane-2-carboxylic acid
(2R)-3,4-dihydroxyoxolane-2-carboxylic acid (PubChem CID 138535006) has the molecular formula C5H8O5
and a molecular weight of 148.11 g/mol. Its IUPAC name is (2R)-3,4-dihydroxyoxolane-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-3,4-dihydroxyoxolane-2-carboxylic acid |
| PubChem CID | 138535006 |
| Molecular Formula | C5H8O5 |
| Molecular Weight | 148.11 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | (2R)-3,4-dihydroxyoxolane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1OCC(O)C1O |
| InChI | InChI=1S/C5H8O5/c6-2-1-10-4(3(2)7)5(8)9/h2-4,6-7H,1H2,(H,8,9)/t2?,3?,4-/m1/s1 |
| InChIKey | IQNBHHRDHLSAIV-RUVKFHFMSA-N |
| XLogP | -1.81 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.11 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-3,4-dihydroxyoxolane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,4-dihydroxyoxolane-2-carboxylic acid?
The IUPAC name of (2R)-3,4-dihydroxyoxolane-2-carboxylic acid (CID 138535006) is (2R)-3,4-dihydroxyoxolane-2-carboxylic acid.
What is the SMILES notation for (2R)-3,4-dihydroxyoxolane-2-carboxylic acid?
The canonical SMILES for (2R)-3,4-dihydroxyoxolane-2-carboxylic acid is O=C(O)[C@@H]1OCC(O)C1O.
What is the InChIKey of (2R)-3,4-dihydroxyoxolane-2-carboxylic acid?
The InChIKey is IQNBHHRDHLSAIV-RUVKFHFMSA-N. The full InChI is InChI=1S/C5H8O5/c6-2-1-10-4(3(2)7)5(8)9/h2-4,6-7H,1H2,(H,8,9)/t2?,3?,4-/m1/s1.
What are the key properties of (2R)-3,4-dihydroxyoxolane-2-carboxylic acid?
(2R)-3,4-dihydroxyoxolane-2-carboxylic acid has a molecular weight of 148.11 g/mol, XLogP of -1.81, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,4-dihydroxyoxolane-2-carboxylic acid is sourced from PubChem (CID 138535006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).