C14H27N3 — CID 138535108
(2E,4Z,6E)-7-[amino(butan-2-yl)amino]-4,5-dimethylocta-2,4,6-trien-2-amine (PubChem CID 138535108) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is (2E,4Z,6E)-7-[amino(butan-2-yl)amino]-4,5-dimethylocta-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z,6E)-7-[amino(butan-2-yl)amino]-4,5-dimethylocta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 138535108 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (2E,4Z,6E)-7-[amino(butan-2-yl)amino]-4,5-dimethylocta-2,4,6-trien-2-amine |
| SMILES | CCC(C)N(N)/C(C)=C/C(C)=C(C)\C=C(/C)N |
| InChI | InChI=1S/C14H27N3/c1-7-13(5)17(16)14(6)9-11(3)10(2)8-12(4)15/h8-9,13H,7,15-16H2,1-6H3/b11-10-,12-8+,14-9+ |
| InChIKey | OPDGKDVGVTWVMB-RAPMJVSDSA-N |
| XLogP | 3.06 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|