About 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole
1-ethyl-6-methyl-3a,4-dihydrobenzotriazole (PubChem CID 138535114) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole.
Molecular Properties
| Compound Name | 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole |
| PubChem CID | 138535114 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole |
| SMILES | CCN1N=NC2CC=C(C)C=C21 |
| InChI | InChI=1S/C9H13N3/c1-3-12-9-6-7(2)4-5-8(9)10-11-12/h4,6,8H,3,5H2,1-2H3 |
| InChIKey | KGHYSDQRRMLPPS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole?
The IUPAC name of 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole (CID 138535114) is 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole.
What is the SMILES notation for 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole?
The canonical SMILES for 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole is CCN1N=NC2CC=C(C)C=C21.
What is the InChIKey of 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole?
The InChIKey is KGHYSDQRRMLPPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-3-12-9-6-7(2)4-5-8(9)10-11-12/h4,6,8H,3,5H2,1-2H3.
What are the key properties of 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole?
1-ethyl-6-methyl-3a,4-dihydrobenzotriazole has a molecular weight of 163.22 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-6-methyl-3a,4-dihydrobenzotriazole is sourced from PubChem (CID 138535114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).