About 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole
3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole (PubChem CID 138535171) has the molecular formula C10H14FN3
and a molecular weight of 195.24 g/mol. Its IUPAC name is 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole.
Molecular Properties
| Compound Name | 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole |
| PubChem CID | 138535171 |
| Molecular Formula | C10H14FN3 |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole |
| SMILES | CC(C)(C)N1N=NC2=CC=C(F)CC21 |
| InChI | InChI=1S/C10H14FN3/c1-10(2,3)14-9-6-7(11)4-5-8(9)12-13-14/h4-5,9H,6H2,1-3H3 |
| InChIKey | FOQCSYANCNXAMA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole?
The IUPAC name of 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole (CID 138535171) is 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole.
What is the SMILES notation for 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole?
The canonical SMILES for 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole is CC(C)(C)N1N=NC2=CC=C(F)CC21.
What is the InChIKey of 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole?
The InChIKey is FOQCSYANCNXAMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN3/c1-10(2,3)14-9-6-7(11)4-5-8(9)12-13-14/h4-5,9H,6H2,1-3H3.
What are the key properties of 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole?
3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole has a molecular weight of 195.24 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-fluoro-3a,4-dihydrobenzotriazole is sourced from PubChem (CID 138535171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).