C9H14F3N3 — CID 138535212
(1E,3E,5E)-6-hydrazinyl-3-(trifluoromethyl)octa-1,3,5-trien-1-amine (PubChem CID 138535212) has the molecular formula C9H14F3N3 and a molecular weight of 221.23 g/mol. Its IUPAC name is (1E,3E,5E)-6-hydrazinyl-3-(trifluoromethyl)octa-1,3,5-trien-1-amine.
| Compound Name | (1E,3E,5E)-6-hydrazinyl-3-(trifluoromethyl)octa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 138535212 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (1E,3E,5E)-6-hydrazinyl-3-(trifluoromethyl)octa-1,3,5-trien-1-amine |
| SMILES | CC/C(=C\C=C(/C=C/N)C(F)(F)F)NN |
| InChI | InChI=1S/C9H14F3N3/c1-2-8(15-14)4-3-7(5-6-13)9(10,11)12/h3-6,15H,2,13-14H2,1H3/b6-5+,7-3+,8-4+ |
| InChIKey | XESRLWOSNCXGJL-PTKURJLQSA-N |
| XLogP | 1.70 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|