C23H37N3O7 — CID 138535300
N-[(2S)-1-[[(4S)-1,1-dihydroxy-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide (PubChem CID 138535300) has the molecular formula C23H37N3O7 and a molecular weight of 467.56 g/mol. Its IUPAC name is N-[(2S)-1-[[(4S)-1,1-dihydroxy-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide.
| Compound Name | N-[(2S)-1-[[(4S)-1,1-dihydroxy-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 138535300 |
| Molecular Formula | C23H37N3O7 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | N-[(2S)-1-[[(4S)-1,1-dihydroxy-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| SMILES | CC(C)C(=O)[C@H](CCC(O)O)NC(=O)[C@@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C23H37N3O7/c1-14(2)21(23(33)24-16(9-12-20(30)31)22(32)15(3)4)25-17(27)8-6-5-7-13-26-18(28)10-11-19(26)29/h10-11,14-16,20-21,30-31H,5-9,12-13H2,1-4H3,(H,24,33)(H,25,27)/t16-,21-/m0/s1 |
| InChIKey | MVYYKMDQCASXFT-KKSFZXQISA-N |
| XLogP | 0.41 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|