C29H34N8O — CID 138537488
1-(2-tert-butyl-4-pyridinyl)-6-[(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)amino]-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 138537488) has the molecular formula C29H34N8O and a molecular weight of 510.65 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-pyridinyl)-6-[(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)amino]-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(2-tert-butyl-4-pyridinyl)-6-[(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)amino]-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 138537488 |
| Molecular Formula | C29H34N8O |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 1-(2-tert-butyl-4-pyridinyl)-6-[(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)amino]-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | CC(C)n1c(=O)c2cnc(Nc3ccc4c5c(n(C)c4c3)CNCC5)nc2n1-c1ccnc(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H34N8O/c1-17(2)36-27(38)22-15-32-28(34-26(22)37(36)19-9-12-31-25(14-19)29(3,4)5)33-18-7-8-20-21-10-11-30-16-24(21)35(6)23(20)13-18/h7-9,12-15,17,30H,10-11,16H2,1-6H3,(H,32,33,34) |
| InChIKey | OQFDBOLTVHBKGZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|