About (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine
(Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine (PubChem CID 138538446) has the molecular formula C21H46N4
and a molecular weight of 354.63 g/mol. Its IUPAC name is (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine.
Molecular Properties
| Compound Name | (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine |
| PubChem CID | 138538446 |
| Molecular Formula | C21H46N4 |
| Molecular Weight | 354.63 g/mol |
| Exact Mass | 354.37 |
| IUPAC Name | (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine |
| SMILES | CC(C)CCC/C(=C/CCCCN(CCCN)CCCN)CCCN |
| InChI | InChI=1S/C21H46N4/c1-20(2)10-6-12-21(13-7-14-22)11-4-3-5-17-25(18-8-15-23)19-9-16-24/h11,20H,3-10,12-19,22-24H2,1-2H3/b21-11- |
| InChIKey | XKAXEWJLDJBJGB-NHDPSOOVSA-N |
| XLogP | 3.65 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.63 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine?
The IUPAC name of (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine (CID 138538446) is (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine.
What is the SMILES notation for (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine?
The canonical SMILES for (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine is CC(C)CCC/C(=C/CCCCN(CCCN)CCCN)CCCN.
What is the InChIKey of (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine?
The InChIKey is XKAXEWJLDJBJGB-NHDPSOOVSA-N. The full InChI is InChI=1S/C21H46N4/c1-20(2)10-6-12-21(13-7-14-22)11-4-3-5-17-25(18-8-15-23)19-9-16-24/h11,20H,3-10,12-19,22-24H2,1-2H3/b21-11-.
What are the key properties of (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine?
(Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine has a molecular weight of 354.63 g/mol, XLogP of 3.65, 18 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N',N'-bis(3-aminopropyl)-4-(4-methylpentyl)non-4-ene-1,9-diamine is sourced from PubChem (CID 138538446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).