C29H37N7O4 — CID 138538538
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[4-(2-methoxyethylamino)benzoyl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 138538538) has the molecular formula C29H37N7O4 and a molecular weight of 547.66 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[4-(2-methoxyethylamino)benzoyl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[4-(2-methoxyethylamino)benzoyl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138538538 |
| Molecular Formula | C29H37N7O4 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[4-(2-methoxyethylamino)benzoyl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(C(=O)c3ccc(NCCOC)cc3)n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C29H37N7O4/c1-7-27(37)32-23-18-24(26(40-6)19-25(23)36(4)16-15-35(2)3)34-29-31-13-12-22(33-29)28(38)20-8-10-21(11-9-20)30-14-17-39-5/h7-13,18-19,30H,1,14-17H2,2-6H3,(H,32,37)(H,31,33,34) |
| InChIKey | JJMADMITDJUTLQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|