About O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate
O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate (PubChem CID 138538954) has the molecular formula C12H22O2S2
and a molecular weight of 262.44 g/mol. Its IUPAC name is O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate.
Molecular Properties
| Compound Name | O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate |
| PubChem CID | 138538954 |
| Molecular Formula | C12H22O2S2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate |
| SMILES | C=COC(CC(C)(C)CC)SC(=S)OCC |
| InChI | InChI=1S/C12H22O2S2/c1-6-12(4,5)9-10(13-7-2)16-11(15)14-8-3/h7,10H,2,6,8-9H2,1,3-5H3 |
| InChIKey | AIILBTSFFLRRJF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate?
The IUPAC name of O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate (CID 138538954) is O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate.
What is the SMILES notation for O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate?
The canonical SMILES for O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate is C=COC(CC(C)(C)CC)SC(=S)OCC.
What is the InChIKey of O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate?
The InChIKey is AIILBTSFFLRRJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2S2/c1-6-12(4,5)9-10(13-7-2)16-11(15)14-8-3/h7,10H,2,6,8-9H2,1,3-5H3.
What are the key properties of O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate?
O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate has a molecular weight of 262.44 g/mol, XLogP of 4.35, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethyl (1-ethenoxy-3,3-dimethylpentyl)sulfanylmethanethioate is sourced from PubChem (CID 138538954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).