C15H24N2 — CID 138539128
1-N-[(Z)-3,4,4-trimethylhex-1-enyl]cyclohex-3-ene-1,2-diimine (PubChem CID 138539128) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-N-[(Z)-3,4,4-trimethylhex-1-enyl]cyclohex-3-ene-1,2-diimine.
| Compound Name | 1-N-[(Z)-3,4,4-trimethylhex-1-enyl]cyclohex-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 138539128 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-N-[(Z)-3,4,4-trimethylhex-1-enyl]cyclohex-3-ene-1,2-diimine |
| SMILES | [H]/N=C1\C=CCC\C1=N/C=C\C(C)C(C)(C)CC |
| InChI | InChI=1S/C15H24N2/c1-5-15(3,4)12(2)10-11-17-14-9-7-6-8-13(14)16/h6,8,10-12,16H,5,7,9H2,1-4H3/b11-10-,16-13+,17-14+ |
| InChIKey | FSQBFFHQEZPMRO-YNOJQECESA-N |
| XLogP | 4.38 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|