C23H18F7N7O3 — CID 138541469
1-[3-[7-[5-fluoro-4-(methylamino)pyrimidin-2-yl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea;2,2,2-trifluoroacetic acid (PubChem CID 138541469) has the molecular formula C23H18F7N7O3 and a molecular weight of 573.43 g/mol. Its IUPAC name is 1-[3-[7-[5-fluoro-4-(methylamino)pyrimidin-2-yl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3-[7-[5-fluoro-4-(methylamino)pyrimidin-2-yl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 138541469 |
| Molecular Formula | C23H18F7N7O3 |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | 1-[3-[7-[5-fluoro-4-(methylamino)pyrimidin-2-yl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea;2,2,2-trifluoroacetic acid |
| SMILES | CNc1nc(-c2ccn3c(-c4cccc(NC(=O)NCC(F)(F)F)c4)cnc3c2)ncc1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H17F4N7O.C2HF3O2/c1-26-19-15(22)9-28-18(31-19)13-5-6-32-16(10-27-17(32)8-13)12-3-2-4-14(7-12)30-20(33)29-11-21(23,24)25;3-2(4,5)1(6)7/h2-10H,11H2,1H3,(H,26,28,31)(H2,29,30,33);(H,6,7) |
| InChIKey | GKXVEHGLQHUDMJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 133.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |