C36H38N8O3S2 — CID 138541545
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-3-[1-[2-[[2-(1-benzothiophen-3-yl)-9-propan-2-ylpurin-6-yl]amino]ethyl]indol-5-yl]pentanoic acid (PubChem CID 138541545) has the molecular formula C36H38N8O3S2 and a molecular weight of 694.89 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-3-[1-[2-[[2-(1-benzothiophen-3-yl)-9-propan-2-ylpurin-6-yl]amino]ethyl]indol-5-yl]pentanoic acid.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-3-[1-[2-[[2-(1-benzothiophen-3-yl)-9-propan-2-ylpurin-6-yl]amino]ethyl]indol-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 138541545 |
| Molecular Formula | C36H38N8O3S2 |
| Molecular Weight | 694.89 g/mol |
| Exact Mass | 694.25 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-3-[1-[2-[[2-(1-benzothiophen-3-yl)-9-propan-2-ylpurin-6-yl]amino]ethyl]indol-5-yl]pentanoic acid |
| SMILES | CC(C)n1cnc2c(NCCn3ccc4cc(C(CC[C@@H]5SC[C@@H]6NC(=O)N[C@@H]65)CC(=O)O)ccc43)nc(-c3csc4ccccc34)nc21 |
| InChI | InChI=1S/C36H38N8O3S2/c1-20(2)44-19-38-32-34(41-33(42-35(32)44)25-17-48-28-6-4-3-5-24(25)28)37-12-14-43-13-11-23-15-21(7-9-27(23)43)22(16-30(45)46)8-10-29-31-26(18-49-29)39-36(47)40-31/h3-7,9,11,13,15,17,19-20,22,26,29,31H,8,10,12,14,16,18H2,1-2H3,(H,45,46)(H,37,41,42)(H2,39,40,47)/t22?,26-,29-,31-/m0/s1 |
| InChIKey | WIBKQCAIGLGHNW-UONSVVNASA-N |
| XLogP | 6.86 |
| TPSA | 138.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.89 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|