C29H30F5N7O2 — CID 138541587
N-[4-fluoro-5-[1-(5-fluoropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 138541587) has the molecular formula C29H30F5N7O2 and a molecular weight of 603.60 g/mol. Its IUPAC name is N-[4-fluoro-5-[1-(5-fluoropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-fluoro-5-[1-(5-fluoropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138541587 |
| Molecular Formula | C29H30F5N7O2 |
| Molecular Weight | 603.60 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | N-[4-fluoro-5-[1-(5-fluoropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CCCN(c4ncc(F)cn4)C3)cc2NC(=O)c2c[nH]c(=O)cc2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C29H30F5N7O2/c1-16-13-41(14-17(2)39(16)3)25-9-23(31)20(18-5-4-6-40(15-18)28-36-10-19(30)11-37-28)7-24(25)38-27(43)21-12-35-26(42)8-22(21)29(32,33)34/h5,7-12,16-17H,4,6,13-15H2,1-3H3,(H,35,42)(H,38,43)/t16-,17+ |
| InChIKey | GYNGZAVRQSHHMV-CALCHBBNSA-N |
| XLogP | 4.54 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|