C31H35F5N6O2 — CID 138541973
N-[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]-4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-fluoro-2-(trifluoromethyl)benzamide (PubChem CID 138541973) has the molecular formula C31H35F5N6O2 and a molecular weight of 618.65 g/mol. Its IUPAC name is N-[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]-4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-fluoro-2-(trifluoromethyl)benzamide.
| Compound Name | N-[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]-4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-fluoro-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 138541973 |
| Molecular Formula | C31H35F5N6O2 |
| Molecular Weight | 618.65 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | N-[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]-4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-fluoro-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H]1CN(c2ncc(-c3cc(NC(=O)c4ccc(F)cc4C(F)(F)F)c(N4C[C@@H](C)N(C)[C@@H](C)C4)cc3F)cn2)C[C@H](C)O1 |
| InChI | InChI=1S/C31H35F5N6O2/c1-17-13-41(14-18(2)40(17)5)28-10-26(33)24(21-11-37-30(38-12-21)42-15-19(3)44-20(4)16-42)9-27(28)39-29(43)23-7-6-22(32)8-25(23)31(34,35)36/h6-12,17-20H,13-16H2,1-5H3,(H,39,43)/t17-,18+,19-,20+ |
| InChIKey | JSSGHMCWUFZLLD-FGYAAKKASA-N |
| XLogP | 5.84 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |