C18H24ClN3O — CID 138543435
2-(chloromethyl)-2-methyl-5-[(4-methylphenyl)methyl]-1-(1H-1,2,4-triazol-5-ylmethyl)cyclopentan-1-ol (PubChem CID 138543435) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is 2-(chloromethyl)-2-methyl-5-[(4-methylphenyl)methyl]-1-(1H-1,2,4-triazol-5-ylmethyl)cyclopentan-1-ol.
| Compound Name | 2-(chloromethyl)-2-methyl-5-[(4-methylphenyl)methyl]-1-(1H-1,2,4-triazol-5-ylmethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 138543435 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-(chloromethyl)-2-methyl-5-[(4-methylphenyl)methyl]-1-(1H-1,2,4-triazol-5-ylmethyl)cyclopentan-1-ol |
| SMILES | Cc1ccc(CC2CCC(C)(CCl)C2(O)Cc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C18H24ClN3O/c1-13-3-5-14(6-4-13)9-15-7-8-17(2,11-19)18(15,23)10-16-20-12-21-22-16/h3-6,12,15,23H,7-11H2,1-2H3,(H,20,21,22) |
| InChIKey | ZCYLXVQWSIEOQF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|