About 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid
8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid (PubChem CID 138543589) has the molecular formula C9H9N3O5
and a molecular weight of 239.19 g/mol. Its IUPAC name is 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid.
Molecular Properties
| Compound Name | 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid |
| PubChem CID | 138543589 |
| Molecular Formula | C9H9N3O5 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid |
| SMILES | O=C(O)N1CCCc2c1c([N+](=O)[O-])cc[n+]2[O-] |
| InChI | InChI=1S/C9H9N3O5/c13-9(14)10-4-1-2-6-8(10)7(12(16)17)3-5-11(6)15/h3,5H,1-2,4H2,(H,13,14) |
| InChIKey | IDBIAVNMRQHXOM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid?
The IUPAC name of 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid (CID 138543589) is 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid.
What is the SMILES notation for 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid?
The canonical SMILES for 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid is O=C(O)N1CCCc2c1c([N+](=O)[O-])cc[n+]2[O-].
What is the InChIKey of 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid?
The InChIKey is IDBIAVNMRQHXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O5/c13-9(14)10-4-1-2-6-8(10)7(12(16)17)3-5-11(6)15/h3,5H,1-2,4H2,(H,13,14).
What are the key properties of 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid?
8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid has a molecular weight of 239.19 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitro-5-oxido-3,4-dihydro-2H-1,5-naphthyridin-5-ium-1-carboxylic acid is sourced from PubChem (CID 138543589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).