C9H10N2O6 — CID 138543731
2-(methoxymethyl)-8-nitro-5-oxido-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-5-ium (PubChem CID 138543731) has the molecular formula C9H10N2O6 and a molecular weight of 242.19 g/mol. Its IUPAC name is 2-(methoxymethyl)-8-nitro-5-oxido-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-5-ium.
| Compound Name | 2-(methoxymethyl)-8-nitro-5-oxido-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-5-ium |
|---|---|
| PubChem CID | 138543731 |
| Molecular Formula | C9H10N2O6 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(methoxymethyl)-8-nitro-5-oxido-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-5-ium |
| SMILES | COCC1COc2c(c([N+](=O)[O-])cc[n+]2[O-])O1 |
| InChI | InChI=1S/C9H10N2O6/c1-15-4-6-5-16-9-8(17-6)7(11(13)14)2-3-10(9)12/h2-3,6H,4-5H2,1H3 |
| InChIKey | RWMRPOHURQWJJL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 97.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|