C20H26F2N2O — CID 138543786
(1R,4S)-2-[4-(4,4-difluoropiperidin-1-yl)phenyl]-7,7-dimethyl-2-azabicyclo[2.2.2]octan-5-one (PubChem CID 138543786) has the molecular formula C20H26F2N2O and a molecular weight of 348.44 g/mol. Its IUPAC name is (1R,4S)-2-[4-(4,4-difluoropiperidin-1-yl)phenyl]-7,7-dimethyl-2-azabicyclo[2.2.2]octan-5-one.
| Compound Name | (1R,4S)-2-[4-(4,4-difluoropiperidin-1-yl)phenyl]-7,7-dimethyl-2-azabicyclo[2.2.2]octan-5-one |
|---|---|
| PubChem CID | 138543786 |
| Molecular Formula | C20H26F2N2O |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (1R,4S)-2-[4-(4,4-difluoropiperidin-1-yl)phenyl]-7,7-dimethyl-2-azabicyclo[2.2.2]octan-5-one |
| SMILES | CC1(C)C[C@H]2CN(c3ccc(N4CCC(F)(F)CC4)cc3)[C@@H]1CC2=O |
| InChI | InChI=1S/C20H26F2N2O/c1-19(2)12-14-13-24(18(19)11-17(14)25)16-5-3-15(4-6-16)23-9-7-20(21,22)8-10-23/h3-6,14,18H,7-13H2,1-2H3/t14-,18+/m0/s1 |
| InChIKey | VYUKBRICDGLCMY-KBXCAEBGSA-N |
| XLogP | 4.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|