About N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride
N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride (PubChem CID 138543829) has the molecular formula C6H20Cl2N4
and a molecular weight of 219.16 g/mol. Its IUPAC name is N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride |
| PubChem CID | 138543829 |
| Molecular Formula | C6H20Cl2N4 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCCN(CCN)CCN |
| InChI | InChI=1S/C6H18N4.2ClH/c7-1-4-10(5-2-8)6-3-9;;/h1-9H2;2*1H |
| InChIKey | ZEDMGDYUMWCHHT-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride?
The IUPAC name of N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride (CID 138543829) is N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride.
What is the SMILES notation for N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride?
The canonical SMILES for N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride is Cl.Cl.NCCN(CCN)CCN.
What is the InChIKey of N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride?
The InChIKey is ZEDMGDYUMWCHHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N4.2ClH/c7-1-4-10(5-2-8)6-3-9;;/h1-9H2;2*1H.
What are the key properties of N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride?
N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride has a molecular weight of 219.16 g/mol, XLogP of -0.99, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dihydrochloride is sourced from PubChem (CID 138543829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).