C23H19Cl2N3O2 — CID 138543849
3-chloro-N-[4-[1-[(6-chloro-3-pyridinyl)carbamoyl]cyclobutyl]phenyl]benzamide (PubChem CID 138543849) has the molecular formula C23H19Cl2N3O2 and a molecular weight of 440.33 g/mol. Its IUPAC name is 3-chloro-N-[4-[1-[(6-chloro-3-pyridinyl)carbamoyl]cyclobutyl]phenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[1-[(6-chloro-3-pyridinyl)carbamoyl]cyclobutyl]phenyl]benzamide |
|---|---|
| PubChem CID | 138543849 |
| Molecular Formula | C23H19Cl2N3O2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 3-chloro-N-[4-[1-[(6-chloro-3-pyridinyl)carbamoyl]cyclobutyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C2(C(=O)Nc3ccc(Cl)nc3)CCC2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H19Cl2N3O2/c24-17-4-1-3-15(13-17)21(29)27-18-7-5-16(6-8-18)23(11-2-12-23)22(30)28-19-9-10-20(25)26-14-19/h1,3-10,13-14H,2,11-12H2,(H,27,29)(H,28,30) |
| InChIKey | TTXKXLJFSQNVKD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|