C19H17FN2O3 — CID 138544073
N-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1-(4-nitrophenyl)cyclobutane-1-carboxamide (PubChem CID 138544073) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is N-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1-(4-nitrophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1-(4-nitrophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 138544073 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1-(4-nitrophenyl)cyclobutane-1-carboxamide |
| SMILES | O=C(NC1Cc2ccc(F)cc21)C1(c2ccc([N+](=O)[O-])cc2)CCC1 |
| InChI | InChI=1S/C19H17FN2O3/c20-14-5-2-12-10-17(16(12)11-14)21-18(23)19(8-1-9-19)13-3-6-15(7-4-13)22(24)25/h2-7,11,17H,1,8-10H2,(H,21,23) |
| InChIKey | RPPARYBAWISWPS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|