C24H39N5O — CID 138544222
4-[2-(heptan-2-ylamino)-5-piperidin-4-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 138544222) has the molecular formula C24H39N5O and a molecular weight of 413.61 g/mol. Its IUPAC name is 4-[2-(heptan-2-ylamino)-5-piperidin-4-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(heptan-2-ylamino)-5-piperidin-4-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 138544222 |
| Molecular Formula | C24H39N5O |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | 4-[2-(heptan-2-ylamino)-5-piperidin-4-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCCC(C)Nc1ncc2c(C3CCNCC3)cc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C24H39N5O/c1-3-4-5-6-17(2)27-24-26-16-23-21(18-11-13-25-14-12-18)15-22(29(23)28-24)19-7-9-20(30)10-8-19/h15-20,25,30H,3-14H2,1-2H3,(H,27,28) |
| InChIKey | PWBRTNOPQDNMQK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|