About 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide
2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide (PubChem CID 138544228) has the molecular formula C8H16F3NOS
and a molecular weight of 231.28 g/mol. Its IUPAC name is 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide.
Molecular Properties
| Compound Name | 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide |
| PubChem CID | 138544228 |
| Molecular Formula | C8H16F3NOS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide |
| SMILES | CC(CC(F)(F)F)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C8H16F3NOS/c1-6(5-8(9,10)11)12-14(13)7(2,3)4/h6,12H,5H2,1-4H3 |
| InChIKey | IDRUPGRMJQWFTD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide?
The IUPAC name of 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide (CID 138544228) is 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide.
What is the SMILES notation for 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide?
The canonical SMILES for 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide is CC(CC(F)(F)F)NS(=O)C(C)(C)C.
What is the InChIKey of 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide?
The InChIKey is IDRUPGRMJQWFTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NOS/c1-6(5-8(9,10)11)12-14(13)7(2,3)4/h6,12H,5H2,1-4H3.
What are the key properties of 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide?
2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide has a molecular weight of 231.28 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(4,4,4-trifluorobutan-2-yl)propane-2-sulfinamide is sourced from PubChem (CID 138544228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).