C25H32FN5O — CID 138544418
4-[5-(4-fluoroanilino)-2-[[(2S)-heptan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-one (PubChem CID 138544418) has the molecular formula C25H32FN5O and a molecular weight of 437.56 g/mol. Its IUPAC name is 4-[5-(4-fluoroanilino)-2-[[(2S)-heptan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-one.
| Compound Name | 4-[5-(4-fluoroanilino)-2-[[(2S)-heptan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 138544418 |
| Molecular Formula | C25H32FN5O |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 4-[5-(4-fluoroanilino)-2-[[(2S)-heptan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-one |
| SMILES | CCCCC[C@H](C)Nc1ncc2c(Nc3ccc(F)cc3)cc(C3CCC(=O)CC3)n2n1 |
| InChI | InChI=1S/C25H32FN5O/c1-3-4-5-6-17(2)28-25-27-16-24-22(29-20-11-9-19(26)10-12-20)15-23(31(24)30-25)18-7-13-21(32)14-8-18/h9-12,15-18,29H,3-8,13-14H2,1-2H3,(H,28,30)/t17-/m0/s1 |
| InChIKey | APAKUXRXOLBJCX-KRWDZBQOSA-N |
| XLogP | 6.22 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|