C21H26FN5O2 — CID 138544546
4-[5-(2-fluoro-4-pyridinyl)-2-(1-methoxypropan-2-ylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 138544546) has the molecular formula C21H26FN5O2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 4-[5-(2-fluoro-4-pyridinyl)-2-(1-methoxypropan-2-ylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[5-(2-fluoro-4-pyridinyl)-2-(1-methoxypropan-2-ylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 138544546 |
| Molecular Formula | C21H26FN5O2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 4-[5-(2-fluoro-4-pyridinyl)-2-(1-methoxypropan-2-ylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | COCC(C)Nc1ncc2c(-c3ccnc(F)c3)cc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C21H26FN5O2/c1-13(12-29-2)25-21-24-11-19-17(15-7-8-23-20(22)9-15)10-18(27(19)26-21)14-3-5-16(28)6-4-14/h7-11,13-14,16,28H,3-6,12H2,1-2H3,(H,25,26) |
| InChIKey | ZPLJLXASPVSANN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|