C23H22Cl2F3N3O7S — CID 138544715
(2R,4S,5R,6R)-6-(3,4-dichlorophenyl)sulfonyl-2-(hydroxymethyl)-5-(2-methoxyethoxy)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-ol (PubChem CID 138544715) has the molecular formula C23H22Cl2F3N3O7S and a molecular weight of 612.41 g/mol. Its IUPAC name is (2R,4S,5R,6R)-6-(3,4-dichlorophenyl)sulfonyl-2-(hydroxymethyl)-5-(2-methoxyethoxy)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-ol.
| Compound Name | (2R,4S,5R,6R)-6-(3,4-dichlorophenyl)sulfonyl-2-(hydroxymethyl)-5-(2-methoxyethoxy)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-ol |
|---|---|
| PubChem CID | 138544715 |
| Molecular Formula | C23H22Cl2F3N3O7S |
| Molecular Weight | 612.41 g/mol |
| Exact Mass | 611.05 |
| IUPAC Name | (2R,4S,5R,6R)-6-(3,4-dichlorophenyl)sulfonyl-2-(hydroxymethyl)-5-(2-methoxyethoxy)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-ol |
| SMILES | COCCO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)C[C@](O)(CO)O[C@@H]1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H22Cl2F3N3O7S/c1-36-4-5-37-21-19(31-10-18(29-30-31)12-6-16(26)20(28)17(27)7-12)9-23(33,11-32)38-22(21)39(34,35)13-2-3-14(24)15(25)8-13/h2-3,6-8,10,19,21-22,32-33H,4-5,9,11H2,1H3/t19-,21+,22+,23+/m0/s1 |
| InChIKey | QQKJYXWSQMHSSP-MLDBQTBOSA-N |
| XLogP | 3.14 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|