C20H23Cl3N4O2 — CID 138544763
[3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-(2,3,6-trichlorophenyl)pyrazin-2-yl]methanol (PubChem CID 138544763) has the molecular formula C20H23Cl3N4O2 and a molecular weight of 457.79 g/mol. Its IUPAC name is [3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-(2,3,6-trichlorophenyl)pyrazin-2-yl]methanol.
| Compound Name | [3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-(2,3,6-trichlorophenyl)pyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 138544763 |
| Molecular Formula | C20H23Cl3N4O2 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | [3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-(2,3,6-trichlorophenyl)pyrazin-2-yl]methanol |
| SMILES | C[C@@H]1OCC2(CCN(c3ncc(-c4c(Cl)ccc(Cl)c4Cl)nc3CO)CC2)[C@@H]1N |
| InChI | InChI=1S/C20H23Cl3N4O2/c1-11-18(24)20(10-29-11)4-6-27(7-5-20)19-15(9-28)26-14(8-25-19)16-12(21)2-3-13(22)17(16)23/h2-3,8,11,18,28H,4-7,9-10,24H2,1H3/t11-,18+/m0/s1 |
| InChIKey | FSDFNQFSSHKSCI-BBATYDOGSA-N |
| XLogP | 3.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|