About 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid
4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (PubChem CID 138544893) has the molecular formula C12H13BrClNO3
and a molecular weight of 334.60 g/mol. Its IUPAC name is 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| PubChem CID | 138544893 |
| Molecular Formula | C12H13BrClNO3 |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| SMILES | CC1(C)OCC(c2ccc(Cl)c(Br)c2)N1C(=O)O |
| InChI | InChI=1S/C12H13BrClNO3/c1-12(2)15(11(16)17)10(6-18-12)7-3-4-9(14)8(13)5-7/h3-5,10H,6H2,1-2H3,(H,16,17) |
| InChIKey | ZGEICCILFICCQU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
The IUPAC name of 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (CID 138544893) is 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
What is the SMILES notation for 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
The canonical SMILES for 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid is CC1(C)OCC(c2ccc(Cl)c(Br)c2)N1C(=O)O.
What is the InChIKey of 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
The InChIKey is ZGEICCILFICCQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrClNO3/c1-12(2)15(11(16)17)10(6-18-12)7-3-4-9(14)8(13)5-7/h3-5,10H,6H2,1-2H3,(H,16,17).
What are the key properties of 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid has a molecular weight of 334.60 g/mol, XLogP of 3.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-4-chlorophenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid is sourced from PubChem (CID 138544893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).