About 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid
2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid (PubChem CID 138544990) has the molecular formula C15H19FN4O2
and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid |
| PubChem CID | 138544990 |
| Molecular Formula | C15H19FN4O2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(N)(C(=O)O)c1ccc(-c2cn[nH]n2)cc1F |
| InChI | InChI=1S/C15H19FN4O2/c1-14(2,3)8-15(17,13(21)22)10-5-4-9(6-11(10)16)12-7-18-20-19-12/h4-7H,8,17H2,1-3H3,(H,21,22)(H,18,19,20) |
| InChIKey | HQDKOQRKAXILEY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid?
The IUPAC name of 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid (CID 138544990) is 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid.
What is the SMILES notation for 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid?
The canonical SMILES for 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid is CC(C)(C)CC(N)(C(=O)O)c1ccc(-c2cn[nH]n2)cc1F.
What is the InChIKey of 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid?
The InChIKey is HQDKOQRKAXILEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN4O2/c1-14(2,3)8-15(17,13(21)22)10-5-4-9(6-11(10)16)12-7-18-20-19-12/h4-7H,8,17H2,1-3H3,(H,21,22)(H,18,19,20).
What are the key properties of 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid?
2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid has a molecular weight of 306.34 g/mol, XLogP of 2.29, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[2-fluoro-4-(2H-triazol-4-yl)phenyl]-4,4-dimethylpentanoic acid is sourced from PubChem (CID 138544990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).