C52H50N6O5S — CID 138545625
methyl 5-[[4-[[4-(3-amino-10,10-dimethyl-6-methyliminothioxanthen-9-yl)-3-methylbenzoyl]amino]cyclohexyl]carbamoyl]-2-(3-amino-6-iminoxanthen-9-yl)benzoate (PubChem CID 138545625) has the molecular formula C52H50N6O5S and a molecular weight of 871.08 g/mol. Its IUPAC name is methyl 5-[[4-[[4-(3-amino-10,10-dimethyl-6-methyliminothioxanthen-9-yl)-3-methylbenzoyl]amino]cyclohexyl]carbamoyl]-2-(3-amino-6-iminoxanthen-9-yl)benzoate.
| Compound Name | methyl 5-[[4-[[4-(3-amino-10,10-dimethyl-6-methyliminothioxanthen-9-yl)-3-methylbenzoyl]amino]cyclohexyl]carbamoyl]-2-(3-amino-6-iminoxanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 138545625 |
| Molecular Formula | C52H50N6O5S |
| Molecular Weight | 871.08 g/mol |
| Exact Mass | 870.36 |
| IUPAC Name | methyl 5-[[4-[[4-(3-amino-10,10-dimethyl-6-methyliminothioxanthen-9-yl)-3-methylbenzoyl]amino]cyclohexyl]carbamoyl]-2-(3-amino-6-iminoxanthen-9-yl)benzoate |
| SMILES | [H]/N=c1/ccc2c(-c3ccc(C(=O)NC4CCC(NC(=O)c5ccc(C6=C7C=C/C(=N\C)C=C7S(C)(C)c7cc(N)ccc76)c(C)c5)CC4)cc3C(=O)OC)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C52H50N6O5S/c1-28-22-29(6-16-37(28)48-41-20-10-33(55)26-46(41)64(4,5)47-27-36(56-2)15-21-42(47)48)50(59)57-34-11-13-35(14-12-34)58-51(60)30-7-17-38(43(23-30)52(61)62-3)49-39-18-8-31(53)24-44(39)63-45-25-32(54)9-19-40(45)49/h6-10,15-27,34-35,53H,11-14,54-55H2,1-5H3,(H,57,59)(H,58,60)/b53-31-,56-36+ |
| InChIKey | SQYWDQAMSUFVHW-GUDPOLRVSA-N |
| XLogP | 9.18 |
| TPSA | 185.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.08 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|