C18H30N2O5 — CID 138546212
2-[1-(8-ethoxycarbonyl-8-azabicyclo[3.2.1]octan-3-yl)piperidin-4-yl]-2-methoxyacetic acid (PubChem CID 138546212) has the molecular formula C18H30N2O5 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[1-(8-ethoxycarbonyl-8-azabicyclo[3.2.1]octan-3-yl)piperidin-4-yl]-2-methoxyacetic acid.
| Compound Name | 2-[1-(8-ethoxycarbonyl-8-azabicyclo[3.2.1]octan-3-yl)piperidin-4-yl]-2-methoxyacetic acid |
|---|---|
| PubChem CID | 138546212 |
| Molecular Formula | C18H30N2O5 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-[1-(8-ethoxycarbonyl-8-azabicyclo[3.2.1]octan-3-yl)piperidin-4-yl]-2-methoxyacetic acid |
| SMILES | CCOC(=O)N1C2CCC1CC(N1CCC(C(OC)C(=O)O)CC1)C2 |
| InChI | InChI=1S/C18H30N2O5/c1-3-25-18(23)20-13-4-5-14(20)11-15(10-13)19-8-6-12(7-9-19)16(24-2)17(21)22/h12-16H,3-11H2,1-2H3,(H,21,22) |
| InChIKey | DDUNDIWENIGKDD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |