C27H38O9 — CID 138546326
tris(4-ethenoxybutyl) cyclohexa-1,3-diene-1,3,5-tricarboxylate (PubChem CID 138546326) has the molecular formula C27H38O9 and a molecular weight of 506.59 g/mol. Its IUPAC name is tris(4-ethenoxybutyl) cyclohexa-1,3-diene-1,3,5-tricarboxylate.
| Compound Name | tris(4-ethenoxybutyl) cyclohexa-1,3-diene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 138546326 |
| Molecular Formula | C27H38O9 |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | tris(4-ethenoxybutyl) cyclohexa-1,3-diene-1,3,5-tricarboxylate |
| SMILES | C=COCCCCOC(=O)C1=CC(C(=O)OCCCCOC=C)CC(C(=O)OCCCCOC=C)=C1 |
| InChI | InChI=1S/C27H38O9/c1-4-31-13-7-10-16-34-25(28)22-19-23(26(29)35-17-11-8-14-32-5-2)21-24(20-22)27(30)36-18-12-9-15-33-6-3/h4-6,19-20,23H,1-3,7-18,21H2 |
| InChIKey | GVYBYWUFCJBRAS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|