About propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate
propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate (PubChem CID 138546412) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate |
| PubChem CID | 138546412 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate |
| SMILES | CCCOC(=O)C1(C)CC[C@H](C)CC1CC(O)O |
| InChI | InChI=1S/C14H26O4/c1-4-7-18-13(17)14(3)6-5-10(2)8-11(14)9-12(15)16/h10-12,15-16H,4-9H2,1-3H3/t10-,11?,14?/m0/s1 |
| InChIKey | GMYHYPIWACYZGF-IFQILLTASA-N |
| XLogP | 2.08 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate?
The IUPAC name of propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate (CID 138546412) is propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate.
What is the SMILES notation for propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate?
The canonical SMILES for propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate is CCCOC(=O)C1(C)CC[C@H](C)CC1CC(O)O.
What is the InChIKey of propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate?
The InChIKey is GMYHYPIWACYZGF-IFQILLTASA-N. The full InChI is InChI=1S/C14H26O4/c1-4-7-18-13(17)14(3)6-5-10(2)8-11(14)9-12(15)16/h10-12,15-16H,4-9H2,1-3H3/t10-,11?,14?/m0/s1.
What are the key properties of propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate?
propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate has a molecular weight of 258.36 g/mol, XLogP of 2.08, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl (4S)-2-(2,2-dihydroxyethyl)-1,4-dimethylcyclohexane-1-carboxylate is sourced from PubChem (CID 138546412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).