C20H25NO3 — CID 138546442
[(1R)-3-hydroxy-6,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-4-yl] acetate (PubChem CID 138546442) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is [(1R)-3-hydroxy-6,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-4-yl] acetate.
| Compound Name | [(1R)-3-hydroxy-6,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-4-yl] acetate |
|---|---|
| PubChem CID | 138546442 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | [(1R)-3-hydroxy-6,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-4-yl] acetate |
| SMILES | CC(=O)Oc1cc(C)c2c(c1O)[C@@]13CCC=CC1C(C2)N(C)CC3 |
| InChI | InChI=1S/C20H25NO3/c1-12-10-17(24-13(2)22)19(23)18-14(12)11-16-15-6-4-5-7-20(15,18)8-9-21(16)3/h4,6,10,15-16,23H,5,7-9,11H2,1-3H3/t15?,16?,20-/m1/s1 |
| InChIKey | ANQPNBKDKWMMGV-ALLBUHFWSA-N |
| XLogP | 3.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|