About N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide
N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide (PubChem CID 138546457) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide.
Molecular Properties
| Compound Name | N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide |
| PubChem CID | 138546457 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide |
| SMILES | C=CC(CCC)NC(=O)COC1=CCC(C)C=C1 |
| InChI | InChI=1S/C15H23NO2/c1-4-6-13(5-2)16-15(17)11-18-14-9-7-12(3)8-10-14/h5,7,9-10,12-13H,2,4,6,8,11H2,1,3H3,(H,16,17) |
| InChIKey | BYINGAFPHDVJFO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide?
The IUPAC name of N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide (CID 138546457) is N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide.
What is the SMILES notation for N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide?
The canonical SMILES for N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide is C=CC(CCC)NC(=O)COC1=CCC(C)C=C1.
What is the InChIKey of N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide?
The InChIKey is BYINGAFPHDVJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-4-6-13(5-2)16-15(17)11-18-14-9-7-12(3)8-10-14/h5,7,9-10,12-13H,2,4,6,8,11H2,1,3H3,(H,16,17).
What are the key properties of N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide?
N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide has a molecular weight of 249.35 g/mol, XLogP of 2.95, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hex-1-en-3-yl-2-(4-methylcyclohexa-1,5-dien-1-yl)oxyacetamide is sourced from PubChem (CID 138546457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).