About (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine
(2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine (PubChem CID 138546688) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine.
Molecular Properties
| Compound Name | (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine |
| PubChem CID | 138546688 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine |
| SMILES | C=C/C=C\C(=C/C)CN(CC)CCOC |
| InChI | InChI=1S/C13H23NO/c1-5-8-9-13(6-2)12-14(7-3)10-11-15-4/h5-6,8-9H,1,7,10-12H2,2-4H3/b9-8-,13-6+ |
| InChIKey | KAWSEDLGBSVRNT-GFBXJKNCSA-N |
| XLogP | 2.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine?
The IUPAC name of (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine (CID 138546688) is (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine.
What is the SMILES notation for (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine?
The canonical SMILES for (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine is C=C/C=C\C(=C/C)CN(CC)CCOC.
What is the InChIKey of (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine?
The InChIKey is KAWSEDLGBSVRNT-GFBXJKNCSA-N. The full InChI is InChI=1S/C13H23NO/c1-5-8-9-13(6-2)12-14(7-3)10-11-15-4/h5-6,8-9H,1,7,10-12H2,2-4H3/b9-8-,13-6+.
What are the key properties of (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine?
(2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine has a molecular weight of 209.33 g/mol, XLogP of 2.64, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-N-ethyl-2-ethylidene-N-(2-methoxyethyl)hexa-3,5-dien-1-amine is sourced from PubChem (CID 138546688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).