C11H21NO2 — CID 138546710
(3E,5E)-4,5-dimethoxy-N-methylocta-3,5-dien-1-amine (PubChem CID 138546710) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (3E,5E)-4,5-dimethoxy-N-methylocta-3,5-dien-1-amine.
| Compound Name | (3E,5E)-4,5-dimethoxy-N-methylocta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 138546710 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (3E,5E)-4,5-dimethoxy-N-methylocta-3,5-dien-1-amine |
| SMILES | CC/C=C(OC)\C(=C/CCNC)OC |
| InChI | InChI=1S/C11H21NO2/c1-5-7-10(13-3)11(14-4)8-6-9-12-2/h7-8,12H,5-6,9H2,1-4H3/b10-7+,11-8+ |
| InChIKey | XPYAEAQLCAKISE-AMMQDNIMSA-N |
| XLogP | 2.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|