C13H23N3 — CID 138546715
(2Z,5Z)-N',2-dimethyl-3-(methylideneamino)deca-2,5-dienimidamide (PubChem CID 138546715) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is (2Z,5Z)-N',2-dimethyl-3-(methylideneamino)deca-2,5-dienimidamide.
| Compound Name | (2Z,5Z)-N',2-dimethyl-3-(methylideneamino)deca-2,5-dienimidamide |
|---|---|
| PubChem CID | 138546715 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | (2Z,5Z)-N',2-dimethyl-3-(methylideneamino)deca-2,5-dienimidamide |
| SMILES | C=N/C(C/C=C\CCCC)=C(C)\C(N)=N\C |
| InChI | InChI=1S/C13H23N3/c1-5-6-7-8-9-10-12(15-3)11(2)13(14)16-4/h8-9H,3,5-7,10H2,1-2,4H3,(H2,14,16)/b9-8-,12-11- |
| InChIKey | QCGHOPDRIWXECS-MURFETPASA-N |
| XLogP | 3.08 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|