C13H13NO3 — CID 138547075
3-[(E)-3-(4-methylphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 138547075) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-[(E)-3-(4-methylphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-3-(4-methylphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138547075 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-[(E)-3-(4-methylphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCOC2=O)cc1 |
| InChI | InChI=1S/C13H13NO3/c1-10-2-4-11(5-3-10)6-7-12(15)14-8-9-17-13(14)16/h2-7H,8-9H2,1H3/b7-6+ |
| InChIKey | MLCSNVAGZACYOI-VOTSOKGWSA-N |
| XLogP | 1.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|