C31H39N3O — CID 138547348
2-[2-tert-butyl-6-[(1E,3E)-3-methyl-4-(2,2,8,8-tetramethyl-9-methylidene-3,4,6,7-tetrahydroquinolizin-1-yl)buta-1,3-dienyl]pyran-4-ylidene]propanedinitrile (PubChem CID 138547348) has the molecular formula C31H39N3O and a molecular weight of 469.67 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-[(1E,3E)-3-methyl-4-(2,2,8,8-tetramethyl-9-methylidene-3,4,6,7-tetrahydroquinolizin-1-yl)buta-1,3-dienyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-tert-butyl-6-[(1E,3E)-3-methyl-4-(2,2,8,8-tetramethyl-9-methylidene-3,4,6,7-tetrahydroquinolizin-1-yl)buta-1,3-dienyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 138547348 |
| Molecular Formula | C31H39N3O |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | 2-[2-tert-butyl-6-[(1E,3E)-3-methyl-4-(2,2,8,8-tetramethyl-9-methylidene-3,4,6,7-tetrahydroquinolizin-1-yl)buta-1,3-dienyl]pyran-4-ylidene]propanedinitrile |
| SMILES | C=C1C2=C(/C=C(C)/C=C/C3=CC(=C(C#N)C#N)C=C(C(C)(C)C)O3)C(C)(C)CCN2CCC1(C)C |
| InChI | InChI=1S/C31H39N3O/c1-21(10-11-25-17-23(24(19-32)20-33)18-27(35-25)29(3,4)5)16-26-28-22(2)30(6,7)12-14-34(28)15-13-31(26,8)9/h10-11,16-18H,2,12-15H2,1,3-9H3/b11-10+,21-16+ |
| InChIKey | UUQYTVPHBBJTBQ-UVTDRHCZSA-N |
| XLogP | 7.65 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|