C40H30N4O3 — CID 138547374
11-[4-[5-(4-phenoxazin-10-ylphenyl)-1,3,4-oxadiazol-2-yl]cyclohepta-1,3,5-trien-1-yl]-9,10-dihydro-8H-cyclohepta[b][1,4]benzoxazine (PubChem CID 138547374) has the molecular formula C40H30N4O3 and a molecular weight of 614.71 g/mol. Its IUPAC name is 11-[4-[5-(4-phenoxazin-10-ylphenyl)-1,3,4-oxadiazol-2-yl]cyclohepta-1,3,5-trien-1-yl]-9,10-dihydro-8H-cyclohepta[b][1,4]benzoxazine.
| Compound Name | 11-[4-[5-(4-phenoxazin-10-ylphenyl)-1,3,4-oxadiazol-2-yl]cyclohepta-1,3,5-trien-1-yl]-9,10-dihydro-8H-cyclohepta[b][1,4]benzoxazine |
|---|---|
| PubChem CID | 138547374 |
| Molecular Formula | C40H30N4O3 |
| Molecular Weight | 614.71 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | 11-[4-[5-(4-phenoxazin-10-ylphenyl)-1,3,4-oxadiazol-2-yl]cyclohepta-1,3,5-trien-1-yl]-9,10-dihydro-8H-cyclohepta[b][1,4]benzoxazine |
| SMILES | C1=CC2=C(CCC1)N(C1=CC=C(c3nnc(-c4ccc(N5c6ccccc6Oc6ccccc65)cc4)o3)C=CC1)c1ccccc1O2 |
| InChI | InChI=1S/C40H30N4O3/c1-2-13-31-35(17-3-1)45-36-18-7-4-14-32(36)43(31)29-12-10-11-27(21-24-29)39-41-42-40(47-39)28-22-25-30(26-23-28)44-33-15-5-8-19-37(33)46-38-20-9-6-16-34(38)44/h3-11,14-26H,1-2,12-13H2 |
| InChIKey | ICSKHMUQRKERSS-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 63.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.71 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |