C9H11NS — CID 138547668
3,4,5,5a-tetrahydro-2,1-benzothiazepine (PubChem CID 138547668) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 3,4,5,5a-tetrahydro-2,1-benzothiazepine.
| Compound Name | 3,4,5,5a-tetrahydro-2,1-benzothiazepine |
|---|---|
| PubChem CID | 138547668 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 3,4,5,5a-tetrahydro-2,1-benzothiazepine |
| SMILES | C1=CC2=NSCCCC2C=C1 |
| InChI | InChI=1S/C9H11NS/c1-2-6-9-8(4-1)5-3-7-11-10-9/h1-2,4,6,8H,3,5,7H2 |
| InChIKey | IKHJQHUNMSZKEQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|