C32H47N3O3 — CID 138547850
N-[(6-cycloheptyl-4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-3-[ethyl(oxan-4-yl)amino]-5-ethynyl-2-methylbenzamide (PubChem CID 138547850) has the molecular formula C32H47N3O3 and a molecular weight of 521.75 g/mol. Its IUPAC name is N-[(6-cycloheptyl-4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-3-[ethyl(oxan-4-yl)amino]-5-ethynyl-2-methylbenzamide.
| Compound Name | N-[(6-cycloheptyl-4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-3-[ethyl(oxan-4-yl)amino]-5-ethynyl-2-methylbenzamide |
|---|---|
| PubChem CID | 138547850 |
| Molecular Formula | C32H47N3O3 |
| Molecular Weight | 521.75 g/mol |
| Exact Mass | 521.36 |
| IUPAC Name | N-[(6-cycloheptyl-4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-3-[ethyl(oxan-4-yl)amino]-5-ethynyl-2-methylbenzamide |
| SMILES | C#Cc1cc(C(=O)NCC2C(=O)NC(C)(C3CCCCCC3)CC2C)c(C)c(N(CC)C2CCOCC2)c1 |
| InChI | InChI=1S/C32H47N3O3/c1-6-24-18-27(23(4)29(19-24)35(7-2)26-14-16-38-17-15-26)30(36)33-21-28-22(3)20-32(5,34-31(28)37)25-12-10-8-9-11-13-25/h1,18-19,22,25-26,28H,7-17,20-21H2,2-5H3,(H,33,36)(H,34,37) |
| InChIKey | RTRBFVNEKULWJG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.75 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|