C30H28O8P2 — CID 138547878
(6-diphenoxyphosphanyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) diphenyl phosphite (PubChem CID 138547878) has the molecular formula C30H28O8P2 and a molecular weight of 578.49 g/mol. Its IUPAC name is (6-diphenoxyphosphanyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) diphenyl phosphite.
| Compound Name | (6-diphenoxyphosphanyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) diphenyl phosphite |
|---|---|
| PubChem CID | 138547878 |
| Molecular Formula | C30H28O8P2 |
| Molecular Weight | 578.49 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | (6-diphenoxyphosphanyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) diphenyl phosphite |
| SMILES | c1ccc(OP(Oc2ccccc2)OC2COC3C(OP(Oc4ccccc4)Oc4ccccc4)COC23)cc1 |
| InChI | InChI=1S/C30H28O8P2/c1-5-13-23(14-6-1)33-39(34-24-15-7-2-8-16-24)37-27-21-31-30-28(22-32-29(27)30)38-40(35-25-17-9-3-10-18-25)36-26-19-11-4-12-20-26/h1-20,27-30H,21-22H2 |
| InChIKey | CRYWHIWJUZUPGX-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.49 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|