C10H20N2O — CID 138549226
8-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-7-amine (PubChem CID 138549226) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 8-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-7-amine.
| Compound Name | 8-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-7-amine |
|---|---|
| PubChem CID | 138549226 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 8-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-7-amine |
| SMILES | COC1C(N)CCC2CCCNC21 |
| InChI | InChI=1S/C10H20N2O/c1-13-10-8(11)5-4-7-3-2-6-12-9(7)10/h7-10,12H,2-6,11H2,1H3 |
| InChIKey | OJDPDVQXLBVYBO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |