C47H41FN4 — CID 138549503
3,6-ditert-butyl-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-fluorophenyl)phenyl]carbazole (PubChem CID 138549503) has the molecular formula C47H41FN4 and a molecular weight of 680.87 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-fluorophenyl)phenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-fluorophenyl)phenyl]carbazole |
|---|---|
| PubChem CID | 138549503 |
| Molecular Formula | C47H41FN4 |
| Molecular Weight | 680.87 g/mol |
| Exact Mass | 680.33 |
| IUPAC Name | 3,6-ditert-butyl-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-fluorophenyl)phenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(-c2ccc(F)cc2)ccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C47H41FN4/c1-46(2,3)34-20-25-40-38(28-34)39-29-35(47(4,5)6)21-26-41(39)52(40)42-27-33(30-17-22-36(48)23-18-30)19-24-37(42)45-50-43(31-13-9-7-10-14-31)49-44(51-45)32-15-11-8-12-16-32/h7-29H,1-6H3 |
| InChIKey | HZPODEBWXXDNSJ-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.87 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |