About 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide
4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 138549835) has the molecular formula C18H16N4O3
and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide |
| PubChem CID | 138549835 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(-c3noc(C4CC4)n3)cc2)ccn1 |
| InChI | InChI=1S/C18H16N4O3/c1-19-17(23)15-10-14(8-9-20-15)24-13-6-4-11(5-7-13)16-21-18(25-22-16)12-2-3-12/h4-10,12H,2-3H2,1H3,(H,19,23) |
| InChIKey | SLLKJZPJXJSDBY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide?
The IUPAC name of 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide (CID 138549835) is 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide.
What is the SMILES notation for 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide?
The canonical SMILES for 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide is CNC(=O)c1cc(Oc2ccc(-c3noc(C4CC4)n3)cc2)ccn1.
What is the InChIKey of 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide?
The InChIKey is SLLKJZPJXJSDBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O3/c1-19-17(23)15-10-14(8-9-20-15)24-13-6-4-11(5-7-13)16-21-18(25-22-16)12-2-3-12/h4-10,12H,2-3H2,1H3,(H,19,23).
What are the key properties of 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide?
4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide has a molecular weight of 336.35 g/mol, XLogP of 3.16, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-methylpyridine-2-carboxamide is sourced from PubChem (CID 138549835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).