C18H15FN4 — CID 138550127
1-[1-(2-fluoro-6-methyl-4-pyridinyl)indazol-6-yl]cyclobutane-1-carbonitrile (PubChem CID 138550127) has the molecular formula C18H15FN4 and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-[1-(2-fluoro-6-methyl-4-pyridinyl)indazol-6-yl]cyclobutane-1-carbonitrile.
| Compound Name | 1-[1-(2-fluoro-6-methyl-4-pyridinyl)indazol-6-yl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 138550127 |
| Molecular Formula | C18H15FN4 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1-[1-(2-fluoro-6-methyl-4-pyridinyl)indazol-6-yl]cyclobutane-1-carbonitrile |
| SMILES | Cc1cc(-n2ncc3ccc(C4(C#N)CCC4)cc32)cc(F)n1 |
| InChI | InChI=1S/C18H15FN4/c1-12-7-15(9-17(19)22-12)23-16-8-14(4-3-13(16)10-21-23)18(11-20)5-2-6-18/h3-4,7-10H,2,5-6H2,1H3 |
| InChIKey | ASRMELKQCWEVCV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|