C23H24N2O7 — CID 138550129
(12S,15S)-12-(2-methoxy-2-oxoethyl)-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid (PubChem CID 138550129) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is (12S,15S)-12-(2-methoxy-2-oxoethyl)-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid.
| Compound Name | (12S,15S)-12-(2-methoxy-2-oxoethyl)-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid |
|---|---|
| PubChem CID | 138550129 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (12S,15S)-12-(2-methoxy-2-oxoethyl)-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid |
| SMILES | COC(=O)C[C@@H]1NC(=O)CCc2cccc(c2)Oc2ccc(cc2)C[C@@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C23H24N2O7/c1-31-21(27)13-18-22(28)25-19(23(29)30)12-15-5-8-16(9-6-15)32-17-4-2-3-14(11-17)7-10-20(26)24-18/h2-6,8-9,11,18-19H,7,10,12-13H2,1H3,(H,24,26)(H,25,28)(H,29,30)/t18-,19-/m0/s1 |
| InChIKey | ANTULIFUDAGPKR-OALUTQOASA-N |
| XLogP | 1.58 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |